C16H20N2O4 — CID 68542656
2-[(S)-(2-ethoxyphenoxy)-(1,3-oxazol-2-yl)methyl]morpholine (PubChem CID 68542656) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[(S)-(2-ethoxyphenoxy)-(1,3-oxazol-2-yl)methyl]morpholine.
| Compound Name | 2-[(S)-(2-ethoxyphenoxy)-(1,3-oxazol-2-yl)methyl]morpholine |
|---|---|
| PubChem CID | 68542656 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[(S)-(2-ethoxyphenoxy)-(1,3-oxazol-2-yl)methyl]morpholine |
| SMILES | CCOc1ccccc1O[C@H](c1ncco1)C1CNCCO1 |
| InChI | InChI=1S/C16H20N2O4/c1-2-19-12-5-3-4-6-13(12)22-15(16-18-8-10-21-16)14-11-17-7-9-20-14/h3-6,8,10,14-15,17H,2,7,9,11H2,1H3/t14?,15-/m0/s1 |
| InChIKey | ZAUHFWYHELQZRR-LOACHALJSA-N |
| XLogP | 2.18 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |