C19H22FNO3 — CID 59166814
(2S)-2-[(2-ethoxy-5-fluorophenoxy)-phenylmethyl]morpholine (PubChem CID 59166814) has the molecular formula C19H22FNO3 and a molecular weight of 331.39 g/mol. Its IUPAC name is (2S)-2-[(2-ethoxy-5-fluorophenoxy)-phenylmethyl]morpholine.
| Compound Name | (2S)-2-[(2-ethoxy-5-fluorophenoxy)-phenylmethyl]morpholine |
|---|---|
| PubChem CID | 59166814 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (2S)-2-[(2-ethoxy-5-fluorophenoxy)-phenylmethyl]morpholine |
| SMILES | CCOc1ccc(F)cc1OC(c1ccccc1)[C@@H]1CNCCO1 |
| InChI | InChI=1S/C19H22FNO3/c1-2-22-16-9-8-15(20)12-17(16)24-19(14-6-4-3-5-7-14)18-13-21-10-11-23-18/h3-9,12,18-19,21H,2,10-11,13H2,1H3/t18-,19?/m0/s1 |
| InChIKey | CWHBBFUTGUBLLH-OYKVQYDMSA-N |
| XLogP | 3.33 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |