C18H20FNO2S — CID 68542716
(2S)-2-[(4-fluoro-2-methylsulfanylphenoxy)-phenylmethyl]morpholine (PubChem CID 68542716) has the molecular formula C18H20FNO2S and a molecular weight of 333.43 g/mol. Its IUPAC name is (2S)-2-[(4-fluoro-2-methylsulfanylphenoxy)-phenylmethyl]morpholine.
| Compound Name | (2S)-2-[(4-fluoro-2-methylsulfanylphenoxy)-phenylmethyl]morpholine |
|---|---|
| PubChem CID | 68542716 |
| Molecular Formula | C18H20FNO2S |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2S)-2-[(4-fluoro-2-methylsulfanylphenoxy)-phenylmethyl]morpholine |
| SMILES | CSc1cc(F)ccc1OC(c1ccccc1)[C@@H]1CNCCO1 |
| InChI | InChI=1S/C18H20FNO2S/c1-23-17-11-14(19)7-8-15(17)22-18(13-5-3-2-4-6-13)16-12-20-9-10-21-16/h2-8,11,16,18,20H,9-10,12H2,1H3/t16-,18?/m0/s1 |
| InChIKey | MKFQLZWUHIRNAW-ATNAJCNCSA-N |
| XLogP | 3.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |