C17H17F2NO2 — CID 59166996
(2S)-2-[(S)-(2,5-difluorophenoxy)-phenylmethyl]morpholine (PubChem CID 59166996) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is (2S)-2-[(S)-(2,5-difluorophenoxy)-phenylmethyl]morpholine.
| Compound Name | (2S)-2-[(S)-(2,5-difluorophenoxy)-phenylmethyl]morpholine |
|---|---|
| PubChem CID | 59166996 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2S)-2-[(S)-(2,5-difluorophenoxy)-phenylmethyl]morpholine |
| SMILES | Fc1ccc(F)c(O[C@@H](c2ccccc2)[C@@H]2CNCCO2)c1 |
| InChI | InChI=1S/C17H17F2NO2/c18-13-6-7-14(19)15(10-13)22-17(12-4-2-1-3-5-12)16-11-20-8-9-21-16/h1-7,10,16-17,20H,8-9,11H2/t16-,17-/m0/s1 |
| InChIKey | ZRYYUNQZCRTWPF-IRXDYDNUSA-N |
| XLogP | 3.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |