C17H16Cl2FNO2 — CID 91482587
2-[(S)-(2-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]morpholine (PubChem CID 91482587) has the molecular formula C17H16Cl2FNO2 and a molecular weight of 356.22 g/mol. Its IUPAC name is 2-[(S)-(2-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]morpholine.
| Compound Name | 2-[(S)-(2-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]morpholine |
|---|---|
| PubChem CID | 91482587 |
| Molecular Formula | C17H16Cl2FNO2 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 2-[(S)-(2-chloro-4-fluorophenoxy)-(4-chlorophenyl)methyl]morpholine |
| SMILES | Fc1ccc(O[C@@H](c2ccc(Cl)cc2)C2CNCCO2)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2FNO2/c18-12-3-1-11(2-4-12)17(16-10-21-7-8-22-16)23-15-6-5-13(20)9-14(15)19/h1-6,9,16-17,21H,7-8,10H2/t16?,17-/m0/s1 |
| InChIKey | KVFVGRNOPLJMGE-DJNXLDHESA-N |
| XLogP | 4.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |