C18H20Cl2FNO2 — CID 68597724
(2S)-2-[(S)-(2-chloro-5-fluorophenoxy)-(3-methylphenyl)methyl]morpholine;hydrochloride (PubChem CID 68597724) has the molecular formula C18H20Cl2FNO2 and a molecular weight of 372.27 g/mol. Its IUPAC name is (2S)-2-[(S)-(2-chloro-5-fluorophenoxy)-(3-methylphenyl)methyl]morpholine;hydrochloride.
| Compound Name | (2S)-2-[(S)-(2-chloro-5-fluorophenoxy)-(3-methylphenyl)methyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 68597724 |
| Molecular Formula | C18H20Cl2FNO2 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (2S)-2-[(S)-(2-chloro-5-fluorophenoxy)-(3-methylphenyl)methyl]morpholine;hydrochloride |
| SMILES | Cc1cccc([C@H](Oc2cc(F)ccc2Cl)[C@@H]2CNCCO2)c1.Cl |
| InChI | InChI=1S/C18H19ClFNO2.ClH/c1-12-3-2-4-13(9-12)18(17-11-21-7-8-22-17)23-16-10-14(20)5-6-15(16)19;/h2-6,9-10,17-18,21H,7-8,11H2,1H3;1H/t17-,18-;/m0./s1 |
| InChIKey | BJKJCOIUZMCBME-APTPAJQOSA-N |
| XLogP | 4.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |