C18H20Cl2FNO3 — CID 68598644
(2S)-2-[(2-chloro-4-fluorophenoxy)-(3-methoxyphenyl)methyl]morpholine;hydrochloride (PubChem CID 68598644) has the molecular formula C18H20Cl2FNO3 and a molecular weight of 388.27 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-4-fluorophenoxy)-(3-methoxyphenyl)methyl]morpholine;hydrochloride.
| Compound Name | (2S)-2-[(2-chloro-4-fluorophenoxy)-(3-methoxyphenyl)methyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 68598644 |
| Molecular Formula | C18H20Cl2FNO3 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (2S)-2-[(2-chloro-4-fluorophenoxy)-(3-methoxyphenyl)methyl]morpholine;hydrochloride |
| SMILES | COc1cccc(C(Oc2ccc(F)cc2Cl)[C@@H]2CNCCO2)c1.Cl |
| InChI | InChI=1S/C18H19ClFNO3.ClH/c1-22-14-4-2-3-12(9-14)18(17-11-21-7-8-23-17)24-16-6-5-13(20)10-15(16)19;/h2-6,9-10,17-18,21H,7-8,11H2,1H3;1H/t17-,18?;/m0./s1 |
| InChIKey | VKRYOXVIULIGMT-OQICONIUSA-N |
| XLogP | 4.02 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |