C19H22ClNO4 — CID 68598616
(2S)-2-[(4-chloro-2-methoxyphenoxy)-(3-methoxyphenyl)methyl]morpholine (PubChem CID 68598616) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is (2S)-2-[(4-chloro-2-methoxyphenoxy)-(3-methoxyphenyl)methyl]morpholine.
| Compound Name | (2S)-2-[(4-chloro-2-methoxyphenoxy)-(3-methoxyphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 68598616 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (2S)-2-[(4-chloro-2-methoxyphenoxy)-(3-methoxyphenyl)methyl]morpholine |
| SMILES | COc1cccc(C(Oc2ccc(Cl)cc2OC)[C@@H]2CNCCO2)c1 |
| InChI | InChI=1S/C19H22ClNO4/c1-22-15-5-3-4-13(10-15)19(18-12-21-8-9-24-18)25-16-7-6-14(20)11-17(16)23-2/h3-7,10-11,18-19,21H,8-9,12H2,1-2H3/t18-,19?/m0/s1 |
| InChIKey | BCFTYYKWTOXGFH-OYKVQYDMSA-N |
| XLogP | 3.47 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |