C22H24ClNO7 — CID 68598665
but-2-enedioic acid;(2S)-2-[(S)-(2-chloro-4-methoxyphenoxy)-phenylmethyl]morpholine (PubChem CID 68598665) has the molecular formula C22H24ClNO7 and a molecular weight of 449.89 g/mol. Its IUPAC name is but-2-enedioic acid;(2S)-2-[(S)-(2-chloro-4-methoxyphenoxy)-phenylmethyl]morpholine.
| Compound Name | but-2-enedioic acid;(2S)-2-[(S)-(2-chloro-4-methoxyphenoxy)-phenylmethyl]morpholine |
|---|---|
| PubChem CID | 68598665 |
| Molecular Formula | C22H24ClNO7 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | but-2-enedioic acid;(2S)-2-[(S)-(2-chloro-4-methoxyphenoxy)-phenylmethyl]morpholine |
| SMILES | COc1ccc(O[C@@H](c2ccccc2)[C@@H]2CNCCO2)c(Cl)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H20ClNO3.C4H4O4/c1-21-14-7-8-16(15(19)11-14)23-18(13-5-3-2-4-6-13)17-12-20-9-10-22-17;5-3(6)1-2-4(7)8/h2-8,11,17-18,20H,9-10,12H2,1H3;1-2H,(H,5,6)(H,7,8)/t17-,18-;/m0./s1 |
| InChIKey | XYMWGUXEANNSTK-APTPAJQOSA-N |
| XLogP | 3.17 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|