C21H21Cl2NO6 — CID 68599248
(E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine (PubChem CID 68599248) has the molecular formula C21H21Cl2NO6 and a molecular weight of 454.31 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine.
| Compound Name | (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine |
|---|---|
| PubChem CID | 68599248 |
| Molecular Formula | C21H21Cl2NO6 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine |
| SMILES | Clc1ccc(Cl)c(O[C@@H](c2ccccc2)[C@@H]2CNCCO2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H17Cl2NO2.C4H4O4/c18-13-6-7-14(19)15(10-13)22-17(12-4-2-1-3-5-12)16-11-20-8-9-21-16;5-3(6)1-2-4(7)8/h1-7,10,16-17,20H,8-9,11H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-,17-;/m0./s1 |
| InChIKey | NNFCVOZACNRAAR-PDMJLPKPSA-N |
| XLogP | 3.81 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|