About (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine
(E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine (PubChem CID 68599248) has the molecular formula C21H21Cl2NO6
and a molecular weight of 454.31 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine |
| PubChem CID | 68599248 |
| Molecular Formula | C21H21Cl2NO6 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine |
| SMILES | Clc1ccc(Cl)c(O[C@@H](c2ccccc2)[C@@H]2CNCCO2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H17Cl2NO2.C4H4O4/c18-13-6-7-14(19)15(10-13)22-17(12-4-2-1-3-5-12)16-11-20-8-9-21-16;5-3(6)1-2-4(7)8/h1-7,10,16-17,20H,8-9,11H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-,17-;/m0./s1 |
| InChIKey | NNFCVOZACNRAAR-PDMJLPKPSA-N |
| XLogP | 3.81 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine?
The IUPAC name of (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine (CID 68599248) is (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine.
What is the SMILES notation for (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine?
The canonical SMILES for (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine is Clc1ccc(Cl)c(O[C@@H](c2ccccc2)[C@@H]2CNCCO2)c1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine?
The InChIKey is NNFCVOZACNRAAR-PDMJLPKPSA-N. The full InChI is InChI=1S/C17H17Cl2NO2.C4H4O4/c18-13-6-7-14(19)15(10-13)22-17(12-4-2-1-3-5-12)16-11-20-8-9-21-16;5-3(6)1-2-4(7)8/h1-7,10,16-17,20H,8-9,11H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-,17-;/m0./s1.
What are the key properties of (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine?
(E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine has a molecular weight of 454.31 g/mol, XLogP of 3.81, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;(2S)-2-[(S)-(2,5-dichlorophenoxy)-phenylmethyl]morpholine is sourced from PubChem (CID 68599248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).