C18H18Cl2N2O2 — CID 68599466
5-chloro-2-[[(2R)-morpholin-2-yl]-phenylmethoxy]benzonitrile;hydrochloride (PubChem CID 68599466) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 5-chloro-2-[[(2R)-morpholin-2-yl]-phenylmethoxy]benzonitrile;hydrochloride.
| Compound Name | 5-chloro-2-[[(2R)-morpholin-2-yl]-phenylmethoxy]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 68599466 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 5-chloro-2-[[(2R)-morpholin-2-yl]-phenylmethoxy]benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cc(Cl)ccc1OC(c1ccccc1)[C@H]1CNCCO1 |
| InChI | InChI=1S/C18H17ClN2O2.ClH/c19-15-6-7-16(14(10-15)11-20)23-18(13-4-2-1-3-5-13)17-12-21-8-9-22-17;/h1-7,10,17-18,21H,8-9,12H2;1H/t17-,18?;/m1./s1 |
| InChIKey | JCVPBZWMYJZCTD-XRVQSCEISA-N |
| XLogP | 3.74 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |