C17H16BrCl2NO2 — CID 68597861
(2S)-2-[(S)-(2-bromo-4-chlorophenoxy)-(4-chlorophenyl)methyl]morpholine (PubChem CID 68597861) has the molecular formula C17H16BrCl2NO2 and a molecular weight of 417.13 g/mol. Its IUPAC name is (2S)-2-[(S)-(2-bromo-4-chlorophenoxy)-(4-chlorophenyl)methyl]morpholine.
| Compound Name | (2S)-2-[(S)-(2-bromo-4-chlorophenoxy)-(4-chlorophenyl)methyl]morpholine |
|---|---|
| PubChem CID | 68597861 |
| Molecular Formula | C17H16BrCl2NO2 |
| Molecular Weight | 417.13 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | (2S)-2-[(S)-(2-bromo-4-chlorophenoxy)-(4-chlorophenyl)methyl]morpholine |
| SMILES | Clc1ccc([C@H](Oc2ccc(Cl)cc2Br)[C@@H]2CNCCO2)cc1 |
| InChI | InChI=1S/C17H16BrCl2NO2/c18-14-9-13(20)5-6-15(14)23-17(16-10-21-7-8-22-16)11-1-3-12(19)4-2-11/h1-6,9,16-17,21H,7-8,10H2/t16-,17-/m0/s1 |
| InChIKey | IIRZYJKVKNXSFT-IRXDYDNUSA-N |
| XLogP | 4.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.13 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |