C21H20Cl3NO6 — CID 68598830
but-2-enedioic acid;(2S)-2-[(S)-phenyl-(2,4,6-trichlorophenoxy)methyl]morpholine (PubChem CID 68598830) has the molecular formula C21H20Cl3NO6 and a molecular weight of 488.75 g/mol. Its IUPAC name is but-2-enedioic acid;(2S)-2-[(S)-phenyl-(2,4,6-trichlorophenoxy)methyl]morpholine.
| Compound Name | but-2-enedioic acid;(2S)-2-[(S)-phenyl-(2,4,6-trichlorophenoxy)methyl]morpholine |
|---|---|
| PubChem CID | 68598830 |
| Molecular Formula | C21H20Cl3NO6 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | but-2-enedioic acid;(2S)-2-[(S)-phenyl-(2,4,6-trichlorophenoxy)methyl]morpholine |
| SMILES | Clc1cc(Cl)c(O[C@@H](c2ccccc2)[C@@H]2CNCCO2)c(Cl)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H16Cl3NO2.C4H4O4/c18-12-8-13(19)17(14(20)9-12)23-16(11-4-2-1-3-5-11)15-10-21-6-7-22-15;5-3(6)1-2-4(7)8/h1-5,8-9,15-16,21H,6-7,10H2;1-2H,(H,5,6)(H,7,8)/t15-,16-;/m0./s1 |
| InChIKey | CMAJDZBOXMUBDJ-MOGJOVFKSA-N |
| XLogP | 4.47 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|