C20H25NO4 — CID 10066040
2-[(2-ethoxyphenoxy)-(4-methoxyphenyl)methyl]morpholine (PubChem CID 10066040) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-[(2-ethoxyphenoxy)-(4-methoxyphenyl)methyl]morpholine.
| Compound Name | 2-[(2-ethoxyphenoxy)-(4-methoxyphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 10066040 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-[(2-ethoxyphenoxy)-(4-methoxyphenyl)methyl]morpholine |
| SMILES | CCOc1ccccc1OC(c1ccc(OC)cc1)C1CNCCO1 |
| InChI | InChI=1S/C20H25NO4/c1-3-23-17-6-4-5-7-18(17)25-20(19-14-21-12-13-24-19)15-8-10-16(22-2)11-9-15/h4-11,19-21H,3,12-14H2,1-2H3 |
| InChIKey | PCLUCPPLBUDGNO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |