C18H22N2O3 — CID 59166891
(2R)-2-[(2-ethoxyphenoxy)-pyridin-3-ylmethyl]morpholine (PubChem CID 59166891) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2R)-2-[(2-ethoxyphenoxy)-pyridin-3-ylmethyl]morpholine.
| Compound Name | (2R)-2-[(2-ethoxyphenoxy)-pyridin-3-ylmethyl]morpholine |
|---|---|
| PubChem CID | 59166891 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (2R)-2-[(2-ethoxyphenoxy)-pyridin-3-ylmethyl]morpholine |
| SMILES | CCOc1ccccc1OC(c1cccnc1)[C@H]1CNCCO1 |
| InChI | InChI=1S/C18H22N2O3/c1-2-21-15-7-3-4-8-16(15)23-18(14-6-5-9-19-12-14)17-13-20-10-11-22-17/h3-9,12,17-18,20H,2,10-11,13H2,1H3/t17-,18?/m1/s1 |
| InChIKey | FMOPBZKBYNKBBB-QNSVNVJESA-N |
| XLogP | 2.59 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |