C12H15ClN2O — CID 81432956
N-[2-(6-chloro-1,3-benzoxazol-2-yl)ethyl]propan-2-amine (PubChem CID 81432956) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is N-[2-(6-chloro-1,3-benzoxazol-2-yl)ethyl]propan-2-amine.
| Compound Name | N-[2-(6-chloro-1,3-benzoxazol-2-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 81432956 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | N-[2-(6-chloro-1,3-benzoxazol-2-yl)ethyl]propan-2-amine |
| SMILES | CC(C)NCCc1nc2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C12H15ClN2O/c1-8(2)14-6-5-12-15-10-4-3-9(13)7-11(10)16-12/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | BPQNUVVWJIVGIV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |