C16H15ClN2O — CID 81433660
N-[2-(6-chloro-1,3-benzoxazol-2-yl)ethyl]-2-methylaniline (PubChem CID 81433660) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is N-[2-(6-chloro-1,3-benzoxazol-2-yl)ethyl]-2-methylaniline.
| Compound Name | N-[2-(6-chloro-1,3-benzoxazol-2-yl)ethyl]-2-methylaniline |
|---|---|
| PubChem CID | 81433660 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-[2-(6-chloro-1,3-benzoxazol-2-yl)ethyl]-2-methylaniline |
| SMILES | Cc1ccccc1NCCc1nc2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C16H15ClN2O/c1-11-4-2-3-5-13(11)18-9-8-16-19-14-7-6-12(17)10-15(14)20-16/h2-7,10,18H,8-9H2,1H3 |
| InChIKey | SOFGQTGSWUGHHK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |