About N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline
N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline (PubChem CID 82005404) has the molecular formula C16H15Cl2N3
and a molecular weight of 320.22 g/mol. Its IUPAC name is N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline.
Molecular Properties
| Compound Name | N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline |
| PubChem CID | 82005404 |
| Molecular Formula | C16H15Cl2N3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline |
| SMILES | Cc1ccccc1NCCc1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H15Cl2N3/c1-10-4-2-3-5-13(10)19-7-6-16-20-14-8-11(17)12(18)9-15(14)21-16/h2-5,8-9,19H,6-7H2,1H3,(H,20,21) |
| InChIKey | WXWMEQYDUOIHRL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline?
The IUPAC name of N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline (CID 82005404) is N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline.
What is the SMILES notation for N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline?
The canonical SMILES for N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline is Cc1ccccc1NCCc1nc2cc(Cl)c(Cl)cc2[nH]1.
What is the InChIKey of N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline?
The InChIKey is WXWMEQYDUOIHRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2N3/c1-10-4-2-3-5-13(10)19-7-6-16-20-14-8-11(17)12(18)9-15(14)21-16/h2-5,8-9,19H,6-7H2,1H3,(H,20,21).
What are the key properties of N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline?
N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline has a molecular weight of 320.22 g/mol, XLogP of 4.83, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline is sourced from PubChem (CID 82005404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).