C16H15Cl2N3 — CID 82005404
N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline (PubChem CID 82005404) has the molecular formula C16H15Cl2N3 and a molecular weight of 320.22 g/mol. Its IUPAC name is N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline.
| Compound Name | N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline |
|---|---|
| PubChem CID | 82005404 |
| Molecular Formula | C16H15Cl2N3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]-2-methylaniline |
| SMILES | Cc1ccccc1NCCc1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H15Cl2N3/c1-10-4-2-3-5-13(10)19-7-6-16-20-14-8-11(17)12(18)9-15(14)21-16/h2-5,8-9,19H,6-7H2,1H3,(H,20,21) |
| InChIKey | WXWMEQYDUOIHRL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |