C8H6Cl2N2S — CID 102056508
(5,6-dichloro-1H-benzimidazol-2-yl)methanethiol (PubChem CID 102056508) has the molecular formula C8H6Cl2N2S and a molecular weight of 233.12 g/mol. Its IUPAC name is (5,6-dichloro-1H-benzimidazol-2-yl)methanethiol.
| Compound Name | (5,6-dichloro-1H-benzimidazol-2-yl)methanethiol |
|---|---|
| PubChem CID | 102056508 |
| Molecular Formula | C8H6Cl2N2S |
| Molecular Weight | 233.12 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | (5,6-dichloro-1H-benzimidazol-2-yl)methanethiol |
| SMILES | SCc1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C8H6Cl2N2S/c9-4-1-6-7(2-5(4)10)12-8(3-13)11-6/h1-2,13H,3H2,(H,11,12) |
| InChIKey | SCRCPSNUWXMJNE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.12 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|