C13H9Cl2N3O2 — CID 11846517
1-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]pyrrole-2,5-dione (PubChem CID 11846517) has the molecular formula C13H9Cl2N3O2 and a molecular weight of 310.14 g/mol. Its IUPAC name is 1-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 11846517 |
| Molecular Formula | C13H9Cl2N3O2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 1-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCc1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C13H9Cl2N3O2/c14-7-5-9-10(6-8(7)15)17-11(16-9)3-4-18-12(19)1-2-13(18)20/h1-2,5-6H,3-4H2,(H,16,17) |
| InChIKey | YYHVTQXEDWJUIS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|