C17H18N2O — CID 60837443
2-methyl-N-[2-(6-methyl-1,3-benzoxazol-2-yl)ethyl]aniline (PubChem CID 60837443) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-methyl-N-[2-(6-methyl-1,3-benzoxazol-2-yl)ethyl]aniline.
| Compound Name | 2-methyl-N-[2-(6-methyl-1,3-benzoxazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 60837443 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-methyl-N-[2-(6-methyl-1,3-benzoxazol-2-yl)ethyl]aniline |
| SMILES | Cc1ccc2nc(CCNc3ccccc3C)oc2c1 |
| InChI | InChI=1S/C17H18N2O/c1-12-7-8-15-16(11-12)20-17(19-15)9-10-18-14-6-4-3-5-13(14)2/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | PAJFEOGIIDDELR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |