C13H12N2O2S — CID 102696285
(6-methoxy-1,3-benzoxazol-2-yl)-thiophen-2-ylmethanamine (PubChem CID 102696285) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is (6-methoxy-1,3-benzoxazol-2-yl)-thiophen-2-ylmethanamine.
| Compound Name | (6-methoxy-1,3-benzoxazol-2-yl)-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 102696285 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (6-methoxy-1,3-benzoxazol-2-yl)-thiophen-2-ylmethanamine |
| SMILES | COc1ccc2nc(C(N)c3cccs3)oc2c1 |
| InChI | InChI=1S/C13H12N2O2S/c1-16-8-4-5-9-10(7-8)17-13(15-9)12(14)11-3-2-6-18-11/h2-7,12H,14H2,1H3 |
| InChIKey | IDCSERZONXUDEZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |