C12H16N2O — CID 82230271
N-methyl-1-(5-propyl-1,3-benzoxazol-2-yl)methanamine (PubChem CID 82230271) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-methyl-1-(5-propyl-1,3-benzoxazol-2-yl)methanamine.
| Compound Name | N-methyl-1-(5-propyl-1,3-benzoxazol-2-yl)methanamine |
|---|---|
| PubChem CID | 82230271 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-methyl-1-(5-propyl-1,3-benzoxazol-2-yl)methanamine |
| SMILES | CCCc1ccc2oc(CNC)nc2c1 |
| InChI | InChI=1S/C12H16N2O/c1-3-4-9-5-6-11-10(7-9)14-12(15-11)8-13-2/h5-7,13H,3-4,8H2,1-2H3 |
| InChIKey | QRTAOPOUCNRHSL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |