C10H13N3O — CID 83949471
2-[5-(aminomethyl)-1,3-benzoxazol-2-yl]ethanamine (PubChem CID 83949471) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-[5-(aminomethyl)-1,3-benzoxazol-2-yl]ethanamine.
| Compound Name | 2-[5-(aminomethyl)-1,3-benzoxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 83949471 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-[5-(aminomethyl)-1,3-benzoxazol-2-yl]ethanamine |
| SMILES | NCCc1nc2cc(CN)ccc2o1 |
| InChI | InChI=1S/C10H13N3O/c11-4-3-10-13-8-5-7(6-12)1-2-9(8)14-10/h1-2,5H,3-4,6,11-12H2 |
| InChIKey | YGSRRVKWZNNXBE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |