C9H11N3O — CID 83949465
[2-(aminomethyl)-1,3-benzoxazol-5-yl]methanamine (PubChem CID 83949465) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is [2-(aminomethyl)-1,3-benzoxazol-5-yl]methanamine.
| Compound Name | [2-(aminomethyl)-1,3-benzoxazol-5-yl]methanamine |
|---|---|
| PubChem CID | 83949465 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | [2-(aminomethyl)-1,3-benzoxazol-5-yl]methanamine |
| SMILES | NCc1ccc2oc(CN)nc2c1 |
| InChI | InChI=1S/C9H11N3O/c10-4-6-1-2-8-7(3-6)12-9(5-11)13-8/h1-3H,4-5,10-11H2 |
| InChIKey | PTEPHIZUBSLJKT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |