C9H9BrN2O — CID 118825667
[6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine (PubChem CID 118825667) has the molecular formula C9H9BrN2O and a molecular weight of 241.09 g/mol. Its IUPAC name is [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine.
| Compound Name | [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine |
|---|---|
| PubChem CID | 118825667 |
| Molecular Formula | C9H9BrN2O |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine |
| SMILES | NCc1nc2ccc(CBr)cc2o1 |
| InChI | InChI=1S/C9H9BrN2O/c10-4-6-1-2-7-8(3-6)13-9(5-11)12-7/h1-3H,4-5,11H2 |
| InChIKey | ZJLHMYVKKNFRQJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|