About [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine
[6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine (PubChem CID 118825667) has the molecular formula C9H9BrN2O
and a molecular weight of 241.09 g/mol. Its IUPAC name is [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine |
| PubChem CID | 118825667 |
| Molecular Formula | C9H9BrN2O |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine |
| SMILES | NCc1nc2ccc(CBr)cc2o1 |
| InChI | InChI=1S/C9H9BrN2O/c10-4-6-1-2-7-8(3-6)13-9(5-11)12-7/h1-3H,4-5,11H2 |
| InChIKey | ZJLHMYVKKNFRQJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine?
The IUPAC name of [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine (CID 118825667) is [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine.
What is the SMILES notation for [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine?
The canonical SMILES for [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine is NCc1nc2ccc(CBr)cc2o1.
What is the InChIKey of [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine?
The InChIKey is ZJLHMYVKKNFRQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O/c10-4-6-1-2-7-8(3-6)13-9(5-11)12-7/h1-3H,4-5,11H2.
What are the key properties of [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine?
[6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine has a molecular weight of 241.09 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(bromomethyl)-1,3-benzoxazol-2-yl]methanamine is sourced from PubChem (CID 118825667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).