C9H8BrNOS — CID 118808916
2-(bromomethyl)-6-methylsulfanyl-1,3-benzoxazole (PubChem CID 118808916) has the molecular formula C9H8BrNOS and a molecular weight of 258.14 g/mol. Its IUPAC name is 2-(bromomethyl)-6-methylsulfanyl-1,3-benzoxazole.
| Compound Name | 2-(bromomethyl)-6-methylsulfanyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 118808916 |
| Molecular Formula | C9H8BrNOS |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | 2-(bromomethyl)-6-methylsulfanyl-1,3-benzoxazole |
| SMILES | CSc1ccc2nc(CBr)oc2c1 |
| InChI | InChI=1S/C9H8BrNOS/c1-13-6-2-3-7-8(4-6)12-9(5-10)11-7/h2-4H,5H2,1H3 |
| InChIKey | YBBOZCKFEBCQBK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|