C14H18N2O — CID 166557495
(7-cyclopropyl-2-propan-2-yl-1,3-benzoxazol-5-yl)methanamine (PubChem CID 166557495) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (7-cyclopropyl-2-propan-2-yl-1,3-benzoxazol-5-yl)methanamine.
| Compound Name | (7-cyclopropyl-2-propan-2-yl-1,3-benzoxazol-5-yl)methanamine |
|---|---|
| PubChem CID | 166557495 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (7-cyclopropyl-2-propan-2-yl-1,3-benzoxazol-5-yl)methanamine |
| SMILES | CC(C)c1nc2cc(CN)cc(C3CC3)c2o1 |
| InChI | InChI=1S/C14H18N2O/c1-8(2)14-16-12-6-9(7-15)5-11(10-3-4-10)13(12)17-14/h5-6,8,10H,3-4,7,15H2,1-2H3 |
| InChIKey | APPVXHOGKVTNRY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |