C13H13Cl2FN2O2 — CID 65237377
N-[[5-(2,4-dichloro-5-fluorophenyl)-1,2-oxazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 65237377) has the molecular formula C13H13Cl2FN2O2 and a molecular weight of 319.16 g/mol. Its IUPAC name is N-[[5-(2,4-dichloro-5-fluorophenyl)-1,2-oxazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(2,4-dichloro-5-fluorophenyl)-1,2-oxazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 65237377 |
| Molecular Formula | C13H13Cl2FN2O2 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | N-[[5-(2,4-dichloro-5-fluorophenyl)-1,2-oxazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cnoc1-c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2FN2O2/c1-19-3-2-17-6-8-7-18-20-13(8)9-4-12(16)11(15)5-10(9)14/h4-5,7,17H,2-3,6H2,1H3 |
| InChIKey | KQOBZMYKVRHYCT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|