C11H9Cl2FN2O — CID 65239871
1-[5-(2,4-dichloro-5-fluorophenyl)-1,2-oxazol-4-yl]-N-methylmethanamine (PubChem CID 65239871) has the molecular formula C11H9Cl2FN2O and a molecular weight of 275.11 g/mol. Its IUPAC name is 1-[5-(2,4-dichloro-5-fluorophenyl)-1,2-oxazol-4-yl]-N-methylmethanamine.
| Compound Name | 1-[5-(2,4-dichloro-5-fluorophenyl)-1,2-oxazol-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 65239871 |
| Molecular Formula | C11H9Cl2FN2O |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 1-[5-(2,4-dichloro-5-fluorophenyl)-1,2-oxazol-4-yl]-N-methylmethanamine |
| SMILES | CNCc1cnoc1-c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2FN2O/c1-15-4-6-5-16-17-11(6)7-2-10(14)9(13)3-8(7)12/h2-3,5,15H,4H2,1H3 |
| InChIKey | SNPFBXZFRYEYLV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|