C14H11Cl2F2N — CID 107476910
1-[5-chloro-2-(2-chloro-4,5-difluorophenyl)phenyl]-N-methylmethanamine (PubChem CID 107476910) has the molecular formula C14H11Cl2F2N and a molecular weight of 302.15 g/mol. Its IUPAC name is 1-[5-chloro-2-(2-chloro-4,5-difluorophenyl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[5-chloro-2-(2-chloro-4,5-difluorophenyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107476910 |
| Molecular Formula | C14H11Cl2F2N |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 1-[5-chloro-2-(2-chloro-4,5-difluorophenyl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Cl)ccc1-c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C14H11Cl2F2N/c1-19-7-8-4-9(15)2-3-10(8)11-5-13(17)14(18)6-12(11)16/h2-6,19H,7H2,1H3 |
| InChIKey | YNKBPENQRNXIRW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|