C12H13F3N4O2 — CID 106962501
5-[(2-methoxyethylamino)methyl]-N-(2,4,6-trifluorophenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106962501) has the molecular formula C12H13F3N4O2 and a molecular weight of 302.26 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-N-(2,4,6-trifluorophenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-N-(2,4,6-trifluorophenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106962501 |
| Molecular Formula | C12H13F3N4O2 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-N-(2,4,6-trifluorophenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | COCCNCc1nnc(Nc2c(F)cc(F)cc2F)o1 |
| InChI | InChI=1S/C12H13F3N4O2/c1-20-3-2-16-6-10-18-19-12(21-10)17-11-8(14)4-7(13)5-9(11)15/h4-5,16H,2-3,6H2,1H3,(H,17,19) |
| InChIKey | ZZWGBZNJMKJXNF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|