C12H14F2N4O2 — CID 106968469
N-(2,6-difluorophenyl)-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106968469) has the molecular formula C12H14F2N4O2 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(2,6-difluorophenyl)-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106968469 |
| Molecular Formula | C12H14F2N4O2 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-5-[(2-methoxyethylamino)methyl]-1,3,4-oxadiazol-2-amine |
| SMILES | COCCNCc1nnc(Nc2c(F)cccc2F)o1 |
| InChI | InChI=1S/C12H14F2N4O2/c1-19-6-5-15-7-10-17-18-12(20-10)16-11-8(13)3-2-4-9(11)14/h2-4,15H,5-7H2,1H3,(H,16,18) |
| InChIKey | LDOZEVNMVNYFCY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|