C7H2Cl2FNO — CID 138692253
2,6-dichloro-5-fluoro-1,3-benzoxazole (PubChem CID 138692253) has the molecular formula C7H2Cl2FNO and a molecular weight of 206.00 g/mol. Its IUPAC name is 2,6-dichloro-5-fluoro-1,3-benzoxazole.
| Compound Name | 2,6-dichloro-5-fluoro-1,3-benzoxazole |
|---|---|
| PubChem CID | 138692253 |
| Molecular Formula | C7H2Cl2FNO |
| Molecular Weight | 206.00 g/mol |
| Exact Mass | 204.95 |
| IUPAC Name | 2,6-dichloro-5-fluoro-1,3-benzoxazole |
| SMILES | Fc1cc2nc(Cl)oc2cc1Cl |
| InChI | InChI=1S/C7H2Cl2FNO/c8-3-1-6-5(2-4(3)10)11-7(9)12-6/h1-2H |
| InChIKey | UGDIGIBGDZTCOM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.00 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |