C11H10ClFN2O2 — CID 82720658
3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)oxolan-3-amine (PubChem CID 82720658) has the molecular formula C11H10ClFN2O2 and a molecular weight of 256.66 g/mol. Its IUPAC name is 3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)oxolan-3-amine.
| Compound Name | 3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 82720658 |
| Molecular Formula | C11H10ClFN2O2 |
| Molecular Weight | 256.66 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3-(5-chloro-6-fluoro-1,3-benzoxazol-2-yl)oxolan-3-amine |
| SMILES | NC1(c2nc3cc(Cl)c(F)cc3o2)CCOC1 |
| InChI | InChI=1S/C11H10ClFN2O2/c12-6-3-8-9(4-7(6)13)17-10(15-8)11(14)1-2-16-5-11/h3-4H,1-2,5,14H2 |
| InChIKey | HILRQENXEGNZSA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.66 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |