C14H9Cl3N2O — CID 115539598
5-chloro-2-[(3,4-dichlorophenyl)methyl]-1,3-benzoxazol-6-amine (PubChem CID 115539598) has the molecular formula C14H9Cl3N2O and a molecular weight of 327.60 g/mol. Its IUPAC name is 5-chloro-2-[(3,4-dichlorophenyl)methyl]-1,3-benzoxazol-6-amine.
| Compound Name | 5-chloro-2-[(3,4-dichlorophenyl)methyl]-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 115539598 |
| Molecular Formula | C14H9Cl3N2O |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 5-chloro-2-[(3,4-dichlorophenyl)methyl]-1,3-benzoxazol-6-amine |
| SMILES | Nc1cc2oc(Cc3ccc(Cl)c(Cl)c3)nc2cc1Cl |
| InChI | InChI=1S/C14H9Cl3N2O/c15-8-2-1-7(3-9(8)16)4-14-19-12-5-10(17)11(18)6-13(12)20-14/h1-3,5-6H,4,18H2 |
| InChIKey | YLVMIMSAIFXUSH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|