C11H19N5 — CID 151369939
2-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine (PubChem CID 151369939) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 2-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 151369939 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(CCN2CCCCC2)n1 |
| InChI | InChI=1S/C11H19N5/c12-9-8-10(13)15-11(14-9)4-7-16-5-2-1-3-6-16/h8H,1-7H2,(H4,12,13,14,15) |
| InChIKey | OQFMHOQXWGDYIL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |