C17H30N6 — CID 174751032
4,6-bis(2-piperidin-1-ylethyl)-1,3,5-triazin-2-amine (PubChem CID 174751032) has the molecular formula C17H30N6 and a molecular weight of 318.47 g/mol. Its IUPAC name is 4,6-bis(2-piperidin-1-ylethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(2-piperidin-1-ylethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 174751032 |
| Molecular Formula | C17H30N6 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | 4,6-bis(2-piperidin-1-ylethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(CCN2CCCCC2)nc(CCN2CCCCC2)n1 |
| InChI | InChI=1S/C17H30N6/c18-17-20-15(7-13-22-9-3-1-4-10-22)19-16(21-17)8-14-23-11-5-2-6-12-23/h1-14H2,(H2,18,19,20,21) |
| InChIKey | MUPYJHJHGZGEKX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |