C13H19N7 — CID 141264101
6-[2-(2-methyl-4,5,6,7-tetrahydrobenzimidazol-1-yl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 141264101) has the molecular formula C13H19N7 and a molecular weight of 273.34 g/mol. Its IUPAC name is 6-[2-(2-methyl-4,5,6,7-tetrahydrobenzimidazol-1-yl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-(2-methyl-4,5,6,7-tetrahydrobenzimidazol-1-yl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 141264101 |
| Molecular Formula | C13H19N7 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 6-[2-(2-methyl-4,5,6,7-tetrahydrobenzimidazol-1-yl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1nc2c(n1CCc1nc(N)nc(N)n1)CCCC2 |
| InChI | InChI=1S/C13H19N7/c1-8-16-9-4-2-3-5-10(9)20(8)7-6-11-17-12(14)19-13(15)18-11/h2-7H2,1H3,(H4,14,15,17,18,19) |
| InChIKey | LGSYUOMNMXMDOY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |