C16H13ClN2O — CID 115539806
5-chloro-2-(2-phenylcyclopropyl)-1,3-benzoxazol-6-amine (PubChem CID 115539806) has the molecular formula C16H13ClN2O and a molecular weight of 284.75 g/mol. Its IUPAC name is 5-chloro-2-(2-phenylcyclopropyl)-1,3-benzoxazol-6-amine.
| Compound Name | 5-chloro-2-(2-phenylcyclopropyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 115539806 |
| Molecular Formula | C16H13ClN2O |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-chloro-2-(2-phenylcyclopropyl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1cc2oc(C3CC3c3ccccc3)nc2cc1Cl |
| InChI | InChI=1S/C16H13ClN2O/c17-12-7-14-15(8-13(12)18)20-16(19-14)11-6-10(11)9-4-2-1-3-5-9/h1-5,7-8,10-11H,6,18H2 |
| InChIKey | FYARKKOHHDANLM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|