C10H5ClF6N2O — CID 103309949
5-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-benzoxazol-6-amine (PubChem CID 103309949) has the molecular formula C10H5ClF6N2O and a molecular weight of 318.60 g/mol. Its IUPAC name is 5-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 5-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 103309949 |
| Molecular Formula | C10H5ClF6N2O |
| Molecular Weight | 318.60 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 5-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1cc2oc(C(C(F)(F)F)C(F)(F)F)nc2cc1Cl |
| InChI | InChI=1S/C10H5ClF6N2O/c11-3-1-5-6(2-4(3)18)20-8(19-5)7(9(12,13)14)10(15,16)17/h1-2,7H,18H2 |
| InChIKey | IPUFJFZYDIOTLZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|