C13H7Cl2IN2O — CID 103220838
5-chloro-2-(3-chloro-4-iodophenyl)-1,3-benzoxazol-6-amine (PubChem CID 103220838) has the molecular formula C13H7Cl2IN2O and a molecular weight of 405.02 g/mol. Its IUPAC name is 5-chloro-2-(3-chloro-4-iodophenyl)-1,3-benzoxazol-6-amine.
| Compound Name | 5-chloro-2-(3-chloro-4-iodophenyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 103220838 |
| Molecular Formula | C13H7Cl2IN2O |
| Molecular Weight | 405.02 g/mol |
| Exact Mass | 403.90 |
| IUPAC Name | 5-chloro-2-(3-chloro-4-iodophenyl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1cc2oc(-c3ccc(I)c(Cl)c3)nc2cc1Cl |
| InChI | InChI=1S/C13H7Cl2IN2O/c14-7-3-6(1-2-9(7)16)13-18-11-4-8(15)10(17)5-12(11)19-13/h1-5H,17H2 |
| InChIKey | SXOZBDPCORPZQG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.02 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|