C12H9ClN2O2 — CID 114820837
5-chloro-2-(5-methylfuran-3-yl)-1,3-benzoxazol-6-amine (PubChem CID 114820837) has the molecular formula C12H9ClN2O2 and a molecular weight of 248.67 g/mol. Its IUPAC name is 5-chloro-2-(5-methylfuran-3-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 5-chloro-2-(5-methylfuran-3-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 114820837 |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-chloro-2-(5-methylfuran-3-yl)-1,3-benzoxazol-6-amine |
| SMILES | Cc1cc(-c2nc3cc(Cl)c(N)cc3o2)co1 |
| InChI | InChI=1S/C12H9ClN2O2/c1-6-2-7(5-16-6)12-15-10-3-8(13)9(14)4-11(10)17-12/h2-5H,14H2,1H3 |
| InChIKey | RNNMHXQBZVGMFO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|