C11H8ClN3O2 — CID 113331623
5-chloro-2-(5-methyl-1,2-oxazol-3-yl)-1,3-benzoxazol-6-amine (PubChem CID 113331623) has the molecular formula C11H8ClN3O2 and a molecular weight of 249.66 g/mol. Its IUPAC name is 5-chloro-2-(5-methyl-1,2-oxazol-3-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 5-chloro-2-(5-methyl-1,2-oxazol-3-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 113331623 |
| Molecular Formula | C11H8ClN3O2 |
| Molecular Weight | 249.66 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 5-chloro-2-(5-methyl-1,2-oxazol-3-yl)-1,3-benzoxazol-6-amine |
| SMILES | Cc1cc(-c2nc3cc(Cl)c(N)cc3o2)no1 |
| InChI | InChI=1S/C11H8ClN3O2/c1-5-2-9(15-17-5)11-14-8-3-6(12)7(13)4-10(8)16-11/h2-4H,13H2,1H3 |
| InChIKey | NZAWETIJMWNASI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.66 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|