C15H11ClN2OS — CID 115539832
5-chloro-2-(2,3-dihydro-1-benzothiophen-2-yl)-1,3-benzoxazol-6-amine (PubChem CID 115539832) has the molecular formula C15H11ClN2OS and a molecular weight of 302.79 g/mol. Its IUPAC name is 5-chloro-2-(2,3-dihydro-1-benzothiophen-2-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 5-chloro-2-(2,3-dihydro-1-benzothiophen-2-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 115539832 |
| Molecular Formula | C15H11ClN2OS |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 5-chloro-2-(2,3-dihydro-1-benzothiophen-2-yl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1cc2oc(C3Cc4ccccc4S3)nc2cc1Cl |
| InChI | InChI=1S/C15H11ClN2OS/c16-9-6-11-12(7-10(9)17)19-15(18-11)14-5-8-3-1-2-4-13(8)20-14/h1-4,6-7,14H,5,17H2 |
| InChIKey | SANXZUQHQBHWAV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|