C17H23ClN2O — CID 115539761
2-(4-butylcyclohexyl)-5-chloro-1,3-benzoxazol-6-amine (PubChem CID 115539761) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 2-(4-butylcyclohexyl)-5-chloro-1,3-benzoxazol-6-amine.
| Compound Name | 2-(4-butylcyclohexyl)-5-chloro-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 115539761 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-(4-butylcyclohexyl)-5-chloro-1,3-benzoxazol-6-amine |
| SMILES | CCCCC1CCC(c2nc3cc(Cl)c(N)cc3o2)CC1 |
| InChI | InChI=1S/C17H23ClN2O/c1-2-3-4-11-5-7-12(8-6-11)17-20-15-9-13(18)14(19)10-16(15)21-17/h9-12H,2-8,19H2,1H3 |
| InChIKey | PCLPOUWXSBLUAP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|