C13H21ClN2O — CID 79555600
5-(4-butylcyclohexyl)-4-chloro-1,2-oxazol-3-amine (PubChem CID 79555600) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 5-(4-butylcyclohexyl)-4-chloro-1,2-oxazol-3-amine.
| Compound Name | 5-(4-butylcyclohexyl)-4-chloro-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 79555600 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 5-(4-butylcyclohexyl)-4-chloro-1,2-oxazol-3-amine |
| SMILES | CCCCC1CCC(c2onc(N)c2Cl)CC1 |
| InChI | InChI=1S/C13H21ClN2O/c1-2-3-4-9-5-7-10(8-6-9)12-11(14)13(15)16-17-12/h9-10H,2-8H2,1H3,(H2,15,16) |
| InChIKey | JMGVIXFHQUPGSJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |