C21H24ClFN4O — CID 45142642
2-(4-butylcyclohexyl)-5-[(2E)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile (PubChem CID 45142642) has the molecular formula C21H24ClFN4O and a molecular weight of 402.90 g/mol. Its IUPAC name is 2-(4-butylcyclohexyl)-5-[(2E)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-(4-butylcyclohexyl)-5-[(2E)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 45142642 |
| Molecular Formula | C21H24ClFN4O |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-(4-butylcyclohexyl)-5-[(2E)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
| SMILES | CCCCC1CCC(c2nc(C#N)c(N/N=C/c3c(F)cccc3Cl)o2)CC1 |
| InChI | InChI=1S/C21H24ClFN4O/c1-2-3-5-14-8-10-15(11-9-14)20-26-19(12-24)21(28-20)27-25-13-16-17(22)6-4-7-18(16)23/h4,6-7,13-15,27H,2-3,5,8-11H2,1H3/b25-13+ |
| InChIKey | HMSROBJIWPPYOM-DHRITJCHSA-N |
| XLogP | 6.25 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|