C16H17N3O — CID 104503235
4-[1-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)propan-2-yl]aniline (PubChem CID 104503235) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[1-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)propan-2-yl]aniline.
| Compound Name | 4-[1-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)propan-2-yl]aniline |
|---|---|
| PubChem CID | 104503235 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-[1-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)propan-2-yl]aniline |
| SMILES | Cc1ccc2oc(CC(C)c3ccc(N)cc3)nc2n1 |
| InChI | InChI=1S/C16H17N3O/c1-10(12-4-6-13(17)7-5-12)9-15-19-16-14(20-15)8-3-11(2)18-16/h3-8,10H,9,17H2,1-2H3 |
| InChIKey | DFGQPHOWFALPFC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|