C9H9FN2S — CID 45077196
1-(7-fluoro-1,3-benzothiazol-2-yl)ethanamine (PubChem CID 45077196) has the molecular formula C9H9FN2S and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(7-fluoro-1,3-benzothiazol-2-yl)ethanamine.
| Compound Name | 1-(7-fluoro-1,3-benzothiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 45077196 |
| Molecular Formula | C9H9FN2S |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 1-(7-fluoro-1,3-benzothiazol-2-yl)ethanamine |
| SMILES | CC(N)c1nc2cccc(F)c2s1 |
| InChI | InChI=1S/C9H9FN2S/c1-5(11)9-12-7-4-2-3-6(10)8(7)13-9/h2-5H,11H2,1H3 |
| InChIKey | SUNIHLNKMJYVNM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |